![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| BT_Newsletter_Issue_..> | 2024-11-06 14:22 | 3.6M | |
| Flyer_GIAN Course_II..> | 2024-10-22 16:53 | 5.7M | |
| List of MS project v..> | 2024-11-21 17:22 | 9.4K | |
| List of PhD project ..> | 2024-11-12 11:19 | 14K | |
| List of candidates s..> | 2024-12-05 12:44 | 32K | |
| Logo.png | 2021-09-02 11:13 | 121K | |
| MS-PhD-Jan-2025-admi..> | 2024-10-22 16:53 | 561K | |
| MS-PhD candidates se..> | 2024-12-03 17:31 | 33K | |
| MS-PhD shortlisted f..> | 2024-11-25 14:34 | 37K | |
| MS-PhD shortlisted f..> | 2024-11-25 14:34 | 37K | |
| Shortlisted MS-PhD c..> | 2024-11-25 14:34 | 37K | |
| Shortlisted MS-PhD c..> | 2024-11-13 12:20 | 95K | |
| banner/ | 2024-12-03 17:46 | - | |
| biological.jpg | 2021-09-02 11:13 | 55K | |
| biologicalengg.jpg | 2021-09-02 11:13 | 50K | |
| chemical.jpg | 2021-09-02 11:13 | 782K | |
| computational.jpg | 2021-09-02 11:13 | 75K | |
| content/ | 2024-12-03 17:46 | - | |
| dna1.gif | 2021-09-02 11:13 | 141K | |
| equipment/ | 2024-12-03 17:46 | - | |
| events/ | 2024-12-03 17:46 | - | |
| gallery/ | 2024-12-03 17:46 | - | |
| home-image.png | 2021-09-17 09:04 | 941K | |
| logo2.png | 2021-09-02 11:13 | 435K | |
| news/ | 2024-12-03 17:46 | - | |
| pdf/ | 2024-12-03 17:46 | - | |
| people/ | 2024-12-03 17:46 | - | |
| publications/ | 2024-12-03 17:46 | - | |
| researcharea/ | 2024-12-03 17:46 | - | |
| side.png | 2021-09-02 11:13 | 8.4K | |
